C22H12F4O3S — CID 54582932
3-fluoro-4-thiophen-3-yl-7-[4-(trifluoromethoxy)phenyl]naphthalene-2-carboxylic acid (PubChem CID 54582932) has the molecular formula C22H12F4O3S and a molecular weight of 432.39 g/mol. Its IUPAC name is 3-fluoro-4-thiophen-3-yl-7-[4-(trifluoromethoxy)phenyl]naphthalene-2-carboxylic acid.
| Compound Name | 3-fluoro-4-thiophen-3-yl-7-[4-(trifluoromethoxy)phenyl]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 54582932 |
| Molecular Formula | C22H12F4O3S |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | 3-fluoro-4-thiophen-3-yl-7-[4-(trifluoromethoxy)phenyl]naphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(-c3ccc(OC(F)(F)F)cc3)ccc2c(-c2ccsc2)c1F |
| InChI | InChI=1S/C22H12F4O3S/c23-20-18(21(27)28)10-15-9-13(3-6-17(15)19(20)14-7-8-30-11-14)12-1-4-16(5-2-12)29-22(24,25)26/h1-11H,(H,27,28) |
| InChIKey | UCVZALDHMMNEQF-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |