C10H12N2O — CID 102089655
3-methyl-5-phenyl-2,6-dihydro-1,3,4-oxadiazine (PubChem CID 102089655) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 3-methyl-5-phenyl-2,6-dihydro-1,3,4-oxadiazine.
| Compound Name | 3-methyl-5-phenyl-2,6-dihydro-1,3,4-oxadiazine |
|---|---|
| PubChem CID | 102089655 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 3-methyl-5-phenyl-2,6-dihydro-1,3,4-oxadiazine |
| SMILES | CN1COCC(c2ccccc2)=N1 |
| InChI | InChI=1S/C10H12N2O/c1-12-8-13-7-10(11-12)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 |
| InChIKey | SIPHUUYKQFSOQY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |