C11H13NO — CID 20517773
2,2-dimethyl-4-phenyl-5H-1,3-oxazole (PubChem CID 20517773) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 2,2-dimethyl-4-phenyl-5H-1,3-oxazole.
| Compound Name | 2,2-dimethyl-4-phenyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 20517773 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2,2-dimethyl-4-phenyl-5H-1,3-oxazole |
| SMILES | CC1(C)N=C(c2ccccc2)CO1 |
| InChI | InChI=1S/C11H13NO/c1-11(2)12-10(8-13-11)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| InChIKey | QBMLQURJJUWYBN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |