C17H16N2Na2O6S — CID 102090407
disodium;3-[[(2S,5R,6R)-2-carboxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]imino]-3-oxido-2-phenylpropanoate (PubChem CID 102090407) has the molecular formula C17H16N2Na2O6S and a molecular weight of 422.37 g/mol. Its IUPAC name is disodium;3-[[(2S,5R,6R)-2-carboxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]imino]-3-oxido-2-phenylpropanoate.
| Compound Name | disodium;3-[[(2S,5R,6R)-2-carboxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]imino]-3-oxido-2-phenylpropanoate |
|---|---|
| PubChem CID | 102090407 |
| Molecular Formula | C17H16N2Na2O6S |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | disodium;3-[[(2S,5R,6R)-2-carboxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]imino]-3-oxido-2-phenylpropanoate |
| SMILES | CC1(C)S[C@@H]2[C@H](/N=C(\[O-])C(C(=O)[O-])c3ccccc3)C(=O)N2[C@H]1C(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C17H18N2O6S.2Na/c1-17(2)11(16(24)25)19-13(21)10(14(19)26-17)18-12(20)9(15(22)23)8-6-4-3-5-7-8;;/h3-7,9-11,14H,1-2H3,(H,18,20)(H,22,23)(H,24,25);;/q;2*+1/p-2/t9?,10-,11+,14-;;/m1../s1 |
| InChIKey | RTYJTGSCYUUYAL-YCAHSCEMSA-L |
| XLogP | -7.20 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | -7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|