C17H17Cl2N2NaO5S — CID 168664897
sodium N-(2-carboxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl)-2-(3,4-dichlorophenyl)-2-methoxyethanimidate (PubChem CID 168664897) has the molecular formula C17H17Cl2N2NaO5S and a molecular weight of 455.30 g/mol. Its IUPAC name is sodium N-(2-carboxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl)-2-(3,4-dichlorophenyl)-2-methoxyethanimidate.
| Compound Name | sodium N-(2-carboxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl)-2-(3,4-dichlorophenyl)-2-methoxyethanimidate |
|---|---|
| PubChem CID | 168664897 |
| Molecular Formula | C17H17Cl2N2NaO5S |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | sodium N-(2-carboxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl)-2-(3,4-dichlorophenyl)-2-methoxyethanimidate |
| SMILES | COC(/C([O-])=N/C1C(=O)N2C1SC(C)(C)C2C(=O)O)c1ccc(Cl)c(Cl)c1.[Na+] |
| InChI | InChI=1S/C17H18Cl2N2O5S.Na/c1-17(2)12(16(24)25)21-14(23)10(15(21)27-17)20-13(22)11(26-3)7-4-5-8(18)9(19)6-7;/h4-6,10-12,15H,1-3H3,(H,20,22)(H,24,25);/q;+1/p-1 |
| InChIKey | VJOSJOPYZRNYSD-UHFFFAOYSA-M |
| XLogP | -1.04 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|