C21H29N3O4S — CID 24836765
N-[3,3-dimethyl-7-oxo-2-[2-(trimethylazaniumyl)ethoxycarbonyl]-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-2-phenylethanimidate (PubChem CID 24836765) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is N-[3,3-dimethyl-7-oxo-2-[2-(trimethylazaniumyl)ethoxycarbonyl]-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-2-phenylethanimidate.
| Compound Name | N-[3,3-dimethyl-7-oxo-2-[2-(trimethylazaniumyl)ethoxycarbonyl]-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-2-phenylethanimidate |
|---|---|
| PubChem CID | 24836765 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N-[3,3-dimethyl-7-oxo-2-[2-(trimethylazaniumyl)ethoxycarbonyl]-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-2-phenylethanimidate |
| SMILES | CC1(C)SC2C(/N=C(\[O-])Cc3ccccc3)C(=O)N2C1C(=O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C21H29N3O4S/c1-21(2)17(20(27)28-12-11-24(3,4)5)23-18(26)16(19(23)29-21)22-15(25)13-14-9-7-6-8-10-14/h6-10,16-17,19H,11-13H2,1-5H3 |
| InChIKey | JXHVKIODCDQMIQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|