C19H22NO — CID 102091673
CID 102091673 (PubChem CID 102091673) has the molecular formula C19H22NO and a molecular weight of 280.39 g/mol.
| Compound Name | CID 102091673 |
|---|---|
| PubChem CID | 102091673 |
| Molecular Formula | C19H22NO |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C(=O)NC([CH]c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22NO/c1-19(2,3)18(21)20-17(16-12-8-5-9-13-16)14-15-10-6-4-7-11-15/h4-14,17H,1-3H3,(H,20,21) |
| InChIKey | IKXQQJROKPZGPQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |