C14H22F3INO+ — CID 102091904
butyl-[5,5-dimethyl-3-oxo-2-(2,2,2-trifluoroethyl-λ3-iodanylidene)cyclohexylidene]azanium (PubChem CID 102091904) has the molecular formula C14H22F3INO+ and a molecular weight of 404.23 g/mol. Its IUPAC name is butyl-[5,5-dimethyl-3-oxo-2-(2,2,2-trifluoroethyl-λ3-iodanylidene)cyclohexylidene]azanium.
| Compound Name | butyl-[5,5-dimethyl-3-oxo-2-(2,2,2-trifluoroethyl-λ3-iodanylidene)cyclohexylidene]azanium |
|---|---|
| PubChem CID | 102091904 |
| Molecular Formula | C14H22F3INO+ |
| Molecular Weight | 404.23 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | butyl-[5,5-dimethyl-3-oxo-2-(2,2,2-trifluoroethyl-λ3-iodanylidene)cyclohexylidene]azanium |
| SMILES | CCCC/[NH+]=C1\CC(C)(C)CC(=O)\C1=I/CC(F)(F)F |
| InChI | InChI=1S/C14H21F3INO/c1-4-5-6-19-10-7-13(2,3)8-11(20)12(10)18-9-14(15,16)17/h4-9H2,1-3H3/p+1/b19-10+ |
| InChIKey | XSXNFFIMXLONLS-VXLYETTFSA-O |
| XLogP | 2.40 |
| TPSA | 31.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|