C14H21F3INO — CID 102091905
3-butylimino-5,5-dimethyl-2-(2,2,2-trifluoroethyl-λ3-iodanylidene)cyclohexan-1-one (PubChem CID 102091905) has the molecular formula C14H21F3INO and a molecular weight of 403.23 g/mol. Its IUPAC name is 3-butylimino-5,5-dimethyl-2-(2,2,2-trifluoroethyl-λ3-iodanylidene)cyclohexan-1-one.
| Compound Name | 3-butylimino-5,5-dimethyl-2-(2,2,2-trifluoroethyl-λ3-iodanylidene)cyclohexan-1-one |
|---|---|
| PubChem CID | 102091905 |
| Molecular Formula | C14H21F3INO |
| Molecular Weight | 403.23 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 3-butylimino-5,5-dimethyl-2-(2,2,2-trifluoroethyl-λ3-iodanylidene)cyclohexan-1-one |
| SMILES | CCCC/N=C1\CC(C)(C)CC(=O)\C1=I/CC(F)(F)F |
| InChI | InChI=1S/C14H21F3INO/c1-4-5-6-19-10-7-13(2,3)8-11(20)12(10)18-9-14(15,16)17/h4-9H2,1-3H3/b19-10+ |
| InChIKey | XSXNFFIMXLONLS-VXLYETTFSA-N |
| XLogP | 4.32 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.23 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|