C12H21NO — CID 7012697
5-butylimino-3,3-dimethylcyclohexan-1-one (PubChem CID 7012697) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 5-butylimino-3,3-dimethylcyclohexan-1-one.
| Compound Name | 5-butylimino-3,3-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 7012697 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 5-butylimino-3,3-dimethylcyclohexan-1-one |
| SMILES | CCCC/N=C1\CC(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C12H21NO/c1-4-5-6-13-10-7-11(14)9-12(2,3)8-10/h4-9H2,1-3H3/b13-10+ |
| InChIKey | YAAKCSOFXPPZDC-JLHYYAGUSA-N |
| XLogP | 3.01 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|