C15H25NO — CID 7307155
5-cycloheptylimino-3,3-dimethylcyclohexan-1-one (PubChem CID 7307155) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 5-cycloheptylimino-3,3-dimethylcyclohexan-1-one.
| Compound Name | 5-cycloheptylimino-3,3-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 7307155 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 5-cycloheptylimino-3,3-dimethylcyclohexan-1-one |
| SMILES | CC1(C)CC(=O)C/C(=N\C2CCCCCC2)C1 |
| InChI | InChI=1S/C15H25NO/c1-15(2)10-13(9-14(17)11-15)16-12-7-5-3-4-6-8-12/h12H,3-11H2,1-2H3/b16-13+ |
| InChIKey | MBWAAZUVRKSUGP-DTQAZKPQSA-N |
| XLogP | 3.93 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|