C14H23NO — CID 8025462
5-cyclohexylimino-3,3-dimethylcyclohexan-1-one (PubChem CID 8025462) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 5-cyclohexylimino-3,3-dimethylcyclohexan-1-one.
| Compound Name | 5-cyclohexylimino-3,3-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 8025462 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 5-cyclohexylimino-3,3-dimethylcyclohexan-1-one |
| SMILES | CC1(C)CC(=O)C/C(=N\C2CCCCC2)C1 |
| InChI | InChI=1S/C14H23NO/c1-14(2)9-12(8-13(16)10-14)15-11-6-4-3-5-7-11/h11H,3-10H2,1-2H3/b15-12+ |
| InChIKey | QJAGLQOZJZESRN-NTCAYCPXSA-N |
| XLogP | 3.54 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|