C14H21NO2 — CID 54029308
5,5-dimethyl-2-(2-methyl-2,3,4,5-tetrahydropyridin-6-yl)cyclohexane-1,3-dione (PubChem CID 54029308) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 5,5-dimethyl-2-(2-methyl-2,3,4,5-tetrahydropyridin-6-yl)cyclohexane-1,3-dione.
| Compound Name | 5,5-dimethyl-2-(2-methyl-2,3,4,5-tetrahydropyridin-6-yl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 54029308 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 5,5-dimethyl-2-(2-methyl-2,3,4,5-tetrahydropyridin-6-yl)cyclohexane-1,3-dione |
| SMILES | CC1CCCC(C2C(=O)CC(C)(C)CC2=O)=N1 |
| InChI | InChI=1S/C14H21NO2/c1-9-5-4-6-10(15-9)13-11(16)7-14(2,3)8-12(13)17/h9,13H,4-8H2,1-3H3 |
| InChIKey | LELAEQUDFORWRP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|