C16H27NO2 — CID 7169199
2-butanoyl-3-butylimino-5,5-dimethylcyclohexan-1-one (PubChem CID 7169199) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-butanoyl-3-butylimino-5,5-dimethylcyclohexan-1-one.
| Compound Name | 2-butanoyl-3-butylimino-5,5-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 7169199 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 2-butanoyl-3-butylimino-5,5-dimethylcyclohexan-1-one |
| SMILES | CCCC/N=C1\CC(C)(C)CC(=O)C1C(=O)CCC |
| InChI | InChI=1S/C16H27NO2/c1-5-7-9-17-12-10-16(3,4)11-14(19)15(12)13(18)8-6-2/h15H,5-11H2,1-4H3/b17-12+ |
| InChIKey | JGVJUCFSYIBFRE-SFQUDFHCSA-N |
| XLogP | 3.60 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|