C11H19NO — CID 7309587
3,3-dimethyl-5-propyliminocyclohexan-1-one (PubChem CID 7309587) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 3,3-dimethyl-5-propyliminocyclohexan-1-one.
| Compound Name | 3,3-dimethyl-5-propyliminocyclohexan-1-one |
|---|---|
| PubChem CID | 7309587 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 3,3-dimethyl-5-propyliminocyclohexan-1-one |
| SMILES | CCC/N=C1\CC(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C11H19NO/c1-4-5-12-9-6-10(13)8-11(2,3)7-9/h4-8H2,1-3H3/b12-9+ |
| InChIKey | AMCNROQBYHIJNN-FMIVXFBMSA-N |
| XLogP | 2.62 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|