C10H17NO2 — CID 7013254
5-(2-hydroxyethylimino)-3,3-dimethylcyclohexan-1-one (PubChem CID 7013254) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 5-(2-hydroxyethylimino)-3,3-dimethylcyclohexan-1-one.
| Compound Name | 5-(2-hydroxyethylimino)-3,3-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 7013254 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 5-(2-hydroxyethylimino)-3,3-dimethylcyclohexan-1-one |
| SMILES | CC1(C)CC(=O)C/C(=N\CCO)C1 |
| InChI | InChI=1S/C10H17NO2/c1-10(2)6-8(11-3-4-12)5-9(13)7-10/h12H,3-7H2,1-2H3/b11-8+ |
| InChIKey | KSZVSGYEQMASSI-DHZHZOJOSA-N |
| XLogP | 1.20 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|