C10H19NO2 — CID 86180038
5-(2-hydroxyethylimino)-2,2-dimethylhexan-3-one (PubChem CID 86180038) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 5-(2-hydroxyethylimino)-2,2-dimethylhexan-3-one.
| Compound Name | 5-(2-hydroxyethylimino)-2,2-dimethylhexan-3-one |
|---|---|
| PubChem CID | 86180038 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 5-(2-hydroxyethylimino)-2,2-dimethylhexan-3-one |
| SMILES | C/C(CC(=O)C(C)(C)C)=N\CCO |
| InChI | InChI=1S/C10H19NO2/c1-8(11-5-6-12)7-9(13)10(2,3)4/h12H,5-7H2,1-4H3/b11-8+ |
| InChIKey | QXNOZPMZOYMXTQ-DHZHZOJOSA-N |
| XLogP | 1.44 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|