C12H23NO2 — CID 90989925
5-(1-methoxypropan-2-ylimino)-2,2-dimethylhexan-3-one (PubChem CID 90989925) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 5-(1-methoxypropan-2-ylimino)-2,2-dimethylhexan-3-one.
| Compound Name | 5-(1-methoxypropan-2-ylimino)-2,2-dimethylhexan-3-one |
|---|---|
| PubChem CID | 90989925 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 5-(1-methoxypropan-2-ylimino)-2,2-dimethylhexan-3-one |
| SMILES | COCC(C)/N=C(\C)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C12H23NO2/c1-9(13-10(2)8-15-6)7-11(14)12(3,4)5/h10H,7-8H2,1-6H3/b13-9+ |
| InChIKey | CMTDWWWOJRZAEL-UKTHLTGXSA-N |
| XLogP | 2.49 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|