C12H23NO3 — CID 90704705
5-(2,2-dimethoxyethylimino)-2,2-dimethylhexan-3-one (PubChem CID 90704705) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is 5-(2,2-dimethoxyethylimino)-2,2-dimethylhexan-3-one.
| Compound Name | 5-(2,2-dimethoxyethylimino)-2,2-dimethylhexan-3-one |
|---|---|
| PubChem CID | 90704705 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 5-(2,2-dimethoxyethylimino)-2,2-dimethylhexan-3-one |
| SMILES | COC(C/N=C(\C)CC(=O)C(C)(C)C)OC |
| InChI | InChI=1S/C12H23NO3/c1-9(7-10(14)12(2,3)4)13-8-11(15-5)16-6/h11H,7-8H2,1-6H3/b13-9+ |
| InChIKey | DBQQMJACLSKIHB-UKTHLTGXSA-N |
| XLogP | 2.07 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|