About 4-(2,2-dimethoxyethylimino)pentan-2-one
4-(2,2-dimethoxyethylimino)pentan-2-one (PubChem CID 90969104) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is 4-(2,2-dimethoxyethylimino)pentan-2-one.
Molecular Properties
| Compound Name | 4-(2,2-dimethoxyethylimino)pentan-2-one |
| PubChem CID | 90969104 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 4-(2,2-dimethoxyethylimino)pentan-2-one |
| SMILES | COC(C/N=C(\C)CC(C)=O)OC |
| InChI | InChI=1S/C9H17NO3/c1-7(5-8(2)11)10-6-9(12-3)13-4/h9H,5-6H2,1-4H3/b10-7+ |
| InChIKey | LPWRSTLYBGXFCR-JXMROGBWSA-N |
| XLogP | 1.05 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-dimethoxyethylimino)pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dimethoxyethylimino)pentan-2-one?
The IUPAC name of 4-(2,2-dimethoxyethylimino)pentan-2-one (CID 90969104) is 4-(2,2-dimethoxyethylimino)pentan-2-one.
What is the SMILES notation for 4-(2,2-dimethoxyethylimino)pentan-2-one?
The canonical SMILES for 4-(2,2-dimethoxyethylimino)pentan-2-one is COC(C/N=C(\C)CC(C)=O)OC.
What is the InChIKey of 4-(2,2-dimethoxyethylimino)pentan-2-one?
The InChIKey is LPWRSTLYBGXFCR-JXMROGBWSA-N. The full InChI is InChI=1S/C9H17NO3/c1-7(5-8(2)11)10-6-9(12-3)13-4/h9H,5-6H2,1-4H3/b10-7+.
What are the key properties of 4-(2,2-dimethoxyethylimino)pentan-2-one?
4-(2,2-dimethoxyethylimino)pentan-2-one has a molecular weight of 187.24 g/mol, XLogP of 1.05, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethoxyethylimino)pentan-2-one is sourced from PubChem (CID 90969104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).