C9H14F3NO3 — CID 8025306
4-(2,2-dimethoxyethylimino)-1,1,1-trifluoropentan-2-one (PubChem CID 8025306) has the molecular formula C9H14F3NO3 and a molecular weight of 241.21 g/mol. Its IUPAC name is 4-(2,2-dimethoxyethylimino)-1,1,1-trifluoropentan-2-one.
| Compound Name | 4-(2,2-dimethoxyethylimino)-1,1,1-trifluoropentan-2-one |
|---|---|
| PubChem CID | 8025306 |
| Molecular Formula | C9H14F3NO3 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 4-(2,2-dimethoxyethylimino)-1,1,1-trifluoropentan-2-one |
| SMILES | COC(C/N=C(\C)CC(=O)C(F)(F)F)OC |
| InChI | InChI=1S/C9H14F3NO3/c1-6(4-7(14)9(10,11)12)13-5-8(15-2)16-3/h8H,4-5H2,1-3H3/b13-6+ |
| InChIKey | FZDONXFEOSMIDI-AWNIVKPZSA-N |
| XLogP | 1.59 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|