C8H9F6NO2 — CID 86180035
1,1,1,5,5,5-hexafluoro-4-(2-methoxyethylimino)pentan-2-one (PubChem CID 86180035) has the molecular formula C8H9F6NO2 and a molecular weight of 265.15 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-4-(2-methoxyethylimino)pentan-2-one.
| Compound Name | 1,1,1,5,5,5-hexafluoro-4-(2-methoxyethylimino)pentan-2-one |
|---|---|
| PubChem CID | 86180035 |
| Molecular Formula | C8H9F6NO2 |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-4-(2-methoxyethylimino)pentan-2-one |
| SMILES | COCC/N=C(\CC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H9F6NO2/c1-17-3-2-15-5(7(9,10)11)4-6(16)8(12,13)14/h2-4H2,1H3/b15-5+ |
| InChIKey | KVQJFCJLSFMLBW-PJQLUOCWSA-N |
| XLogP | 2.16 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|