C8H12F3NO2 — CID 8025311
1,1,1-trifluoro-4-(2-methoxyethylimino)pentan-2-one (PubChem CID 8025311) has the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-(2-methoxyethylimino)pentan-2-one.
| Compound Name | 1,1,1-trifluoro-4-(2-methoxyethylimino)pentan-2-one |
|---|---|
| PubChem CID | 8025311 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 1,1,1-trifluoro-4-(2-methoxyethylimino)pentan-2-one |
| SMILES | COCC/N=C(\C)CC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO2/c1-6(12-3-4-14-2)5-7(13)8(9,10)11/h3-5H2,1-2H3/b12-6+ |
| InChIKey | HODAMCKLALFBFT-WUXMJOGZSA-N |
| XLogP | 1.62 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|