C7H10F3NO2 — CID 90899458
1,1,1-trifluoro-4-(2-hydroxyethylimino)pentan-2-one (PubChem CID 90899458) has the molecular formula C7H10F3NO2 and a molecular weight of 197.16 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-(2-hydroxyethylimino)pentan-2-one.
| Compound Name | 1,1,1-trifluoro-4-(2-hydroxyethylimino)pentan-2-one |
|---|---|
| PubChem CID | 90899458 |
| Molecular Formula | C7H10F3NO2 |
| Molecular Weight | 197.16 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 1,1,1-trifluoro-4-(2-hydroxyethylimino)pentan-2-one |
| SMILES | C/C(CC(=O)C(F)(F)F)=N\CCO |
| InChI | InChI=1S/C7H10F3NO2/c1-5(11-2-3-12)4-6(13)7(8,9)10/h12H,2-4H2,1H3/b11-5+ |
| InChIKey | QHDNSWKCQLAMLW-VZUCSPMQSA-N |
| XLogP | 0.96 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.16 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|