C14H21NO4 — CID 57045005
6-[N-(2-hydroxyethyl)-C-methylcarbonimidoyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione (PubChem CID 57045005) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 6-[N-(2-hydroxyethyl)-C-methylcarbonimidoyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione.
| Compound Name | 6-[N-(2-hydroxyethyl)-C-methylcarbonimidoyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 57045005 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 6-[N-(2-hydroxyethyl)-C-methylcarbonimidoyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
| SMILES | C/C(=N\CCO)C1C(=O)C(C)(C)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C14H21NO4/c1-8(15-6-7-16)9-10(17)13(2,3)12(19)14(4,5)11(9)18/h9,16H,6-7H2,1-5H3/b15-8+ |
| InChIKey | FXEKRUXPBNIUGW-OVCLIPMQSA-N |
| XLogP | 0.83 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|