C11H17NO — CID 54017108
7,7-dimethyl-2,3,4,4a,6,8-hexahydroquinolin-5-one (PubChem CID 54017108) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 7,7-dimethyl-2,3,4,4a,6,8-hexahydroquinolin-5-one.
| Compound Name | 7,7-dimethyl-2,3,4,4a,6,8-hexahydroquinolin-5-one |
|---|---|
| PubChem CID | 54017108 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 7,7-dimethyl-2,3,4,4a,6,8-hexahydroquinolin-5-one |
| SMILES | CC1(C)CC(=O)C2CCCN=C2C1 |
| InChI | InChI=1S/C11H17NO/c1-11(2)6-9-8(10(13)7-11)4-3-5-12-9/h8H,3-7H2,1-2H3 |
| InChIKey | KWJMMIGTHLICJW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |