C14H25NO — CID 57088225
5-hexylimino-3,3-dimethylcyclohexan-1-one (PubChem CID 57088225) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 5-hexylimino-3,3-dimethylcyclohexan-1-one.
| Compound Name | 5-hexylimino-3,3-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 57088225 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 5-hexylimino-3,3-dimethylcyclohexan-1-one |
| SMILES | CCCCCC/N=C1\CC(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C14H25NO/c1-4-5-6-7-8-15-12-9-13(16)11-14(2,3)10-12/h4-11H2,1-3H3/b15-12+ |
| InChIKey | KAYLEWKLYAMDCQ-NTCAYCPXSA-N |
| XLogP | 3.79 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|