C9H15NO — CID 57089896
4,4-dimethyl-2-methyliminocyclohexan-1-one (PubChem CID 57089896) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 4,4-dimethyl-2-methyliminocyclohexan-1-one.
| Compound Name | 4,4-dimethyl-2-methyliminocyclohexan-1-one |
|---|---|
| PubChem CID | 57089896 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 4,4-dimethyl-2-methyliminocyclohexan-1-one |
| SMILES | C/N=C1\CC(C)(C)CCC1=O |
| InChI | InChI=1S/C9H15NO/c1-9(2)5-4-8(11)7(6-9)10-3/h4-6H2,1-3H3/b10-7+ |
| InChIKey | IOOFWXADUHHWKN-JXMROGBWSA-N |
| XLogP | 1.84 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|