C19H23IO2 — CID 102094190
2-[(5R)-5-[(E,1S)-7-iodo-1-methoxyhept-4-en-2,6-diynyl]-2,6,6-trimethylcyclohexen-1-yl]acetaldehyde (PubChem CID 102094190) has the molecular formula C19H23IO2 and a molecular weight of 410.30 g/mol. Its IUPAC name is 2-[(5R)-5-[(E,1S)-7-iodo-1-methoxyhept-4-en-2,6-diynyl]-2,6,6-trimethylcyclohexen-1-yl]acetaldehyde.
| Compound Name | 2-[(5R)-5-[(E,1S)-7-iodo-1-methoxyhept-4-en-2,6-diynyl]-2,6,6-trimethylcyclohexen-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 102094190 |
| Molecular Formula | C19H23IO2 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 2-[(5R)-5-[(E,1S)-7-iodo-1-methoxyhept-4-en-2,6-diynyl]-2,6,6-trimethylcyclohexen-1-yl]acetaldehyde |
| SMILES | CO[C@H](C#C/C=C/C#CI)[C@@H]1CCC(C)=C(CC=O)C1(C)C |
| InChI | InChI=1S/C19H23IO2/c1-15-10-11-17(19(2,3)16(15)12-14-21)18(22-4)9-7-5-6-8-13-20/h5-6,14,17-18H,10-12H2,1-4H3/b6-5+/t17-,18+/m0/s1 |
| InChIKey | FEFJQQGWBRAIIT-HQYUYXFKSA-N |
| XLogP | 4.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|