C15H22O2 — CID 134922617
10,11,11-trimethyl-5-oxobicyclo[5.3.1]undec-1(10)-ene-4-carbaldehyde (PubChem CID 134922617) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 10,11,11-trimethyl-5-oxobicyclo[5.3.1]undec-1(10)-ene-4-carbaldehyde.
| Compound Name | 10,11,11-trimethyl-5-oxobicyclo[5.3.1]undec-1(10)-ene-4-carbaldehyde |
|---|---|
| PubChem CID | 134922617 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 10,11,11-trimethyl-5-oxobicyclo[5.3.1]undec-1(10)-ene-4-carbaldehyde |
| SMILES | CC1=C2CCC(C=O)C(=O)CC(CC1)C2(C)C |
| InChI | InChI=1S/C15H22O2/c1-10-4-6-12-8-14(17)11(9-16)5-7-13(10)15(12,2)3/h9,11-12H,4-8H2,1-3H3 |
| InChIKey | PCMATTQKPTWRIK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|