C10H16O2 — CID 90686947
(4R)-3,3,4-trimethyl-2-oxocyclohexane-1-carbaldehyde (PubChem CID 90686947) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (4R)-3,3,4-trimethyl-2-oxocyclohexane-1-carbaldehyde.
| Compound Name | (4R)-3,3,4-trimethyl-2-oxocyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 90686947 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (4R)-3,3,4-trimethyl-2-oxocyclohexane-1-carbaldehyde |
| SMILES | C[C@@H]1CCC(C=O)C(=O)C1(C)C |
| InChI | InChI=1S/C10H16O2/c1-7-4-5-8(6-11)9(12)10(7,2)3/h6-8H,4-5H2,1-3H3/t7-,8?/m1/s1 |
| InChIKey | RRCNIHKGWASEBH-GVHYBUMESA-N |
| XLogP | 1.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|