C26H26N2O2 — CID 166794851
(9aS)-2,9a-dimethyl-7-oxo-3-(3-phenylphenyl)-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole-8-carbaldehyde (PubChem CID 166794851) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is (9aS)-2,9a-dimethyl-7-oxo-3-(3-phenylphenyl)-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole-8-carbaldehyde.
| Compound Name | (9aS)-2,9a-dimethyl-7-oxo-3-(3-phenylphenyl)-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole-8-carbaldehyde |
|---|---|
| PubChem CID | 166794851 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (9aS)-2,9a-dimethyl-7-oxo-3-(3-phenylphenyl)-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole-8-carbaldehyde |
| SMILES | Cc1nc2c(n1-c1cccc(-c3ccccc3)c1)CCC1CC(=O)C(C=O)C[C@]21C |
| InChI | InChI=1S/C26H26N2O2/c1-17-27-25-23(12-11-21-14-24(30)20(16-29)15-26(21,25)2)28(17)22-10-6-9-19(13-22)18-7-4-3-5-8-18/h3-10,13,16,20-21H,11-12,14-15H2,1-2H3/t20?,21?,26-/m0/s1 |
| InChIKey | GFWDOGHCQVLVFI-NSOLWDIASA-N |
| XLogP | 4.85 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|