C27H30N2O2 — CID 166794850
(9'aS)-2',9'a-dimethyl-3'-(3-phenylphenyl)spiro[1,3-dioxolane-2,7'-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole] (PubChem CID 166794850) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is (9'aS)-2',9'a-dimethyl-3'-(3-phenylphenyl)spiro[1,3-dioxolane-2,7'-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole].
| Compound Name | (9'aS)-2',9'a-dimethyl-3'-(3-phenylphenyl)spiro[1,3-dioxolane-2,7'-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole] |
|---|---|
| PubChem CID | 166794850 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (9'aS)-2',9'a-dimethyl-3'-(3-phenylphenyl)spiro[1,3-dioxolane-2,7'-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole] |
| SMILES | Cc1nc2c(n1-c1cccc(-c3ccccc3)c1)CCC1CC3(CC[C@]21C)OCCO3 |
| InChI | InChI=1S/C27H30N2O2/c1-19-28-25-24(12-11-22-18-27(30-15-16-31-27)14-13-26(22,25)2)29(19)23-10-6-9-21(17-23)20-7-4-3-5-8-20/h3-10,17,22H,11-16,18H2,1-2H3/t22?,26-/m0/s1 |
| InChIKey | NRDKVPLFMBYQCQ-XGCAABAXSA-N |
| XLogP | 5.59 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |