C33H28N2 — CID 170020491
1-[3-(3,5-diphenylphenyl)phenyl]-2-ethyl-4,5-dihydrobenzimidazole (PubChem CID 170020491) has the molecular formula C33H28N2 and a molecular weight of 452.60 g/mol. Its IUPAC name is 1-[3-(3,5-diphenylphenyl)phenyl]-2-ethyl-4,5-dihydrobenzimidazole.
| Compound Name | 1-[3-(3,5-diphenylphenyl)phenyl]-2-ethyl-4,5-dihydrobenzimidazole |
|---|---|
| PubChem CID | 170020491 |
| Molecular Formula | C33H28N2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 1-[3-(3,5-diphenylphenyl)phenyl]-2-ethyl-4,5-dihydrobenzimidazole |
| SMILES | CCc1nc2c(n1-c1cccc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c1)C=CCC2 |
| InChI | InChI=1S/C33H28N2/c1-2-33-34-31-18-9-10-19-32(31)35(33)30-17-11-16-26(23-30)29-21-27(24-12-5-3-6-13-24)20-28(22-29)25-14-7-4-8-15-25/h3-8,10-17,19-23H,2,9,18H2,1H3 |
| InChIKey | YIKHINAJTYYSRR-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |