About 1-phenyl-2-pyridin-2-yl-4,5-dihydrobenzimidazole
1-phenyl-2-pyridin-2-yl-4,5-dihydrobenzimidazole (PubChem CID 70894526) has the molecular formula C18H15N3
and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-phenyl-2-pyridin-2-yl-4,5-dihydrobenzimidazole.
Molecular Properties
| Compound Name | 1-phenyl-2-pyridin-2-yl-4,5-dihydrobenzimidazole |
| PubChem CID | 70894526 |
| Molecular Formula | C18H15N3 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 1-phenyl-2-pyridin-2-yl-4,5-dihydrobenzimidazole |
| SMILES | C1=Cc2c(nc(-c3ccccn3)n2-c2ccccc2)CC1 |
| InChI | InChI=1S/C18H15N3/c1-2-8-14(9-3-1)21-17-12-5-4-10-15(17)20-18(21)16-11-6-7-13-19-16/h1-3,5-9,11-13H,4,10H2 |
| InChIKey | OAXANCZDSNMPBA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenyl-2-pyridin-2-yl-4,5-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-2-pyridin-2-yl-4,5-dihydrobenzimidazole?
The IUPAC name of 1-phenyl-2-pyridin-2-yl-4,5-dihydrobenzimidazole (CID 70894526) is 1-phenyl-2-pyridin-2-yl-4,5-dihydrobenzimidazole.
What is the SMILES notation for 1-phenyl-2-pyridin-2-yl-4,5-dihydrobenzimidazole?
The canonical SMILES for 1-phenyl-2-pyridin-2-yl-4,5-dihydrobenzimidazole is C1=Cc2c(nc(-c3ccccn3)n2-c2ccccc2)CC1.
What is the InChIKey of 1-phenyl-2-pyridin-2-yl-4,5-dihydrobenzimidazole?
The InChIKey is OAXANCZDSNMPBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3/c1-2-8-14(9-3-1)21-17-12-5-4-10-15(17)20-18(21)16-11-6-7-13-19-16/h1-3,5-9,11-13H,4,10H2.
What are the key properties of 1-phenyl-2-pyridin-2-yl-4,5-dihydrobenzimidazole?
1-phenyl-2-pyridin-2-yl-4,5-dihydrobenzimidazole has a molecular weight of 273.34 g/mol, XLogP of 3.89, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-2-pyridin-2-yl-4,5-dihydrobenzimidazole is sourced from PubChem (CID 70894526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).