C22H23N3O — CID 162178576
(5aR,6R,9aS)-2,6,9a-trimethyl-3-(3-methylphenyl)-7-oxo-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile (PubChem CID 162178576) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol. Its IUPAC name is (5aR,6R,9aS)-2,6,9a-trimethyl-3-(3-methylphenyl)-7-oxo-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aS)-2,6,9a-trimethyl-3-(3-methylphenyl)-7-oxo-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
|---|---|
| PubChem CID | 162178576 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | (5aR,6R,9aS)-2,6,9a-trimethyl-3-(3-methylphenyl)-7-oxo-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
| SMILES | Cc1cccc(-n2c(C)nc3c2CC[C@@H]2[C@@H](C)C(=O)C(C#N)=C[C@@]32C)c1 |
| InChI | InChI=1S/C22H23N3O/c1-13-6-5-7-17(10-13)25-15(3)24-21-19(25)9-8-18-14(2)20(26)16(12-23)11-22(18,21)4/h5-7,10-11,14,18H,8-9H2,1-4H3/t14-,18-,22-/m1/s1 |
| InChIKey | YRGHRLOJEZPWPN-JPEVHGAISA-N |
| XLogP | 3.98 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |