C25H23N5O — CID 122496303
(5aS,6S,9aR)-2,6,9a-trimethyl-7-oxo-3-(3-pyrimidin-5-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile (PubChem CID 122496303) has the molecular formula C25H23N5O and a molecular weight of 409.49 g/mol. Its IUPAC name is (5aS,6S,9aR)-2,6,9a-trimethyl-7-oxo-3-(3-pyrimidin-5-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile.
| Compound Name | (5aS,6S,9aR)-2,6,9a-trimethyl-7-oxo-3-(3-pyrimidin-5-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
|---|---|
| PubChem CID | 122496303 |
| Molecular Formula | C25H23N5O |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (5aS,6S,9aR)-2,6,9a-trimethyl-7-oxo-3-(3-pyrimidin-5-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
| SMILES | Cc1nc2c(n1-c1cccc(-c3cncnc3)c1)CC[C@H]1[C@H](C)C(=O)C(C#N)=C[C@]21C |
| InChI | InChI=1S/C25H23N5O/c1-15-21-7-8-22-24(25(21,3)10-18(11-26)23(15)31)29-16(2)30(22)20-6-4-5-17(9-20)19-12-27-14-28-13-19/h4-6,9-10,12-15,21H,7-8H2,1-3H3/t15-,21-,25-/m0/s1 |
| InChIKey | FYWJWFIPQOVWKQ-PUAZMWONSA-N |
| XLogP | 4.13 |
| TPSA | 84.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |