About hafnium;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene
hafnium;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene (PubChem CID 175743321) has the molecular formula C10H16Hf
and a molecular weight of 314.73 g/mol. Its IUPAC name is hafnium;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene.
Molecular Properties
| Compound Name | hafnium;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene |
| PubChem CID | 175743321 |
| Molecular Formula | C10H16Hf |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | hafnium;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene |
| SMILES | CC1=C2CC(CC1)C2(C)C.[Hf] |
| InChI | InChI=1S/C10H16.Hf/c1-7-4-5-8-6-9(7)10(8,2)3;/h8H,4-6H2,1-3H3; |
| InChIKey | MESBYVJNBOIUOJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hafnium;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hafnium;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene?
The IUPAC name of hafnium;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene (CID 175743321) is hafnium;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene.
What is the SMILES notation for hafnium;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene?
The canonical SMILES for hafnium;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene is CC1=C2CC(CC1)C2(C)C.[Hf].
What is the InChIKey of hafnium;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene?
The InChIKey is MESBYVJNBOIUOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.Hf/c1-7-4-5-8-6-9(7)10(8,2)3;/h8H,4-6H2,1-3H3;.
What are the key properties of hafnium;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene?
hafnium;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene has a molecular weight of 314.73 g/mol, XLogP of 3.14, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hafnium;2,6,6-trimethylbicyclo[3.1.1]hept-1-ene is sourced from PubChem (CID 175743321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).