C10H14MgN5O12P3S — CID 102094281
magnesium [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [dihydroxy(sulfido)phosphaniumyl] phosphate (PubChem CID 102094281) has the molecular formula C10H14MgN5O12P3S and a molecular weight of 545.54 g/mol. Its IUPAC name is magnesium [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [dihydroxy(sulfido)phosphaniumyl] phosphate.
| Compound Name | magnesium [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [dihydroxy(sulfido)phosphaniumyl] phosphate |
|---|---|
| PubChem CID | 102094281 |
| Molecular Formula | C10H14MgN5O12P3S |
| Molecular Weight | 545.54 g/mol |
| Exact Mass | 544.94 |
| IUPAC Name | magnesium [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [dihydroxy(sulfido)phosphaniumyl] phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])O[P+](O)(O)[S-])[C@@H](O)[C@H]1O.[Mg+2] |
| InChI | InChI=1S/C10H16N5O12P3S.Mg/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(25-10)1-24-28(18,19)26-29(20,21)27-30(22,23)31;/h2-4,6-7,10,16-17H,1H2,(H,18,19)(H,20,21)(H2,11,12,13)(H2,22,23,31);/q;+2/p-2/t4-,6-,7-,10-;/m1./s1 |
| InChIKey | FLVBLYYUHCBXLM-MCDZGGTQSA-L |
| XLogP | -3.16 |
| TPSA | 267.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.54 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|