C13H13ClF6N2 — CID 102095240
4-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-2-ethyl-5,6,7,8-tetrahydroquinazoline (PubChem CID 102095240) has the molecular formula C13H13ClF6N2 and a molecular weight of 346.70 g/mol. Its IUPAC name is 4-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-2-ethyl-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 4-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-2-ethyl-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 102095240 |
| Molecular Formula | C13H13ClF6N2 |
| Molecular Weight | 346.70 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 4-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-2-ethyl-5,6,7,8-tetrahydroquinazoline |
| SMILES | CCc1nc2c(c(C(F)(F)C(F)(F)C(F)(F)Cl)n1)CCCC2 |
| InChI | InChI=1S/C13H13ClF6N2/c1-2-9-21-8-6-4-3-5-7(8)10(22-9)11(15,16)12(17,18)13(14,19)20/h2-6H2,1H3 |
| InChIKey | VWUIOUATZKBHFG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.70 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|