C19H24BNO6 — CID 102096908
[4-[3,5-bis(ethoxycarbonyl)-2,6-dimethyl-1,4-dihydropyridin-4-yl]phenyl]boronic acid (PubChem CID 102096908) has the molecular formula C19H24BNO6 and a molecular weight of 373.21 g/mol. Its IUPAC name is [4-[3,5-bis(ethoxycarbonyl)-2,6-dimethyl-1,4-dihydropyridin-4-yl]phenyl]boronic acid.
| Compound Name | [4-[3,5-bis(ethoxycarbonyl)-2,6-dimethyl-1,4-dihydropyridin-4-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 102096908 |
| Molecular Formula | C19H24BNO6 |
| Molecular Weight | 373.21 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | [4-[3,5-bis(ethoxycarbonyl)-2,6-dimethyl-1,4-dihydropyridin-4-yl]phenyl]boronic acid |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C19H24BNO6/c1-5-26-18(22)15-11(3)21-12(4)16(19(23)27-6-2)17(15)13-7-9-14(10-8-13)20(24)25/h7-10,17,21,24-25H,5-6H2,1-4H3 |
| InChIKey | MWWMTBPDNJWDNW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.21 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|