C17H20BNO6 — CID 56839786
[3-[3,5-bis(methoxycarbonyl)-2,6-dimethyl-1,4-dihydropyridin-4-yl]phenyl]boronic acid (PubChem CID 56839786) has the molecular formula C17H20BNO6 and a molecular weight of 345.16 g/mol. Its IUPAC name is [3-[3,5-bis(methoxycarbonyl)-2,6-dimethyl-1,4-dihydropyridin-4-yl]phenyl]boronic acid.
| Compound Name | [3-[3,5-bis(methoxycarbonyl)-2,6-dimethyl-1,4-dihydropyridin-4-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 56839786 |
| Molecular Formula | C17H20BNO6 |
| Molecular Weight | 345.16 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | [3-[3,5-bis(methoxycarbonyl)-2,6-dimethyl-1,4-dihydropyridin-4-yl]phenyl]boronic acid |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1cccc(B(O)O)c1 |
| InChI | InChI=1S/C17H20BNO6/c1-9-13(16(20)24-3)15(14(10(2)19-9)17(21)25-4)11-6-5-7-12(8-11)18(22)23/h5-8,15,19,22-23H,1-4H3 |
| InChIKey | SERCQYIKDCEPLE-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.16 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|