C20H27NO4Si — CID 15040763
dimethyl 2,6-dimethyl-4-(3-trimethylsilylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 15040763) has the molecular formula C20H27NO4Si and a molecular weight of 373.53 g/mol. Its IUPAC name is dimethyl 2,6-dimethyl-4-(3-trimethylsilylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 2,6-dimethyl-4-(3-trimethylsilylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 15040763 |
| Molecular Formula | C20H27NO4Si |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | dimethyl 2,6-dimethyl-4-(3-trimethylsilylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1cccc([Si](C)(C)C)c1 |
| InChI | InChI=1S/C20H27NO4Si/c1-12-16(19(22)24-3)18(17(13(2)21-12)20(23)25-4)14-9-8-10-15(11-14)26(5,6)7/h8-11,18,21H,1-7H3 |
| InChIKey | ARQCBPNRHHASFW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|