C19H18F6N2O4 — CID 15209637
dimethyl 4-[3-[bis(trifluoromethyl)amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 15209637) has the molecular formula C19H18F6N2O4 and a molecular weight of 452.35 g/mol. Its IUPAC name is dimethyl 4-[3-[bis(trifluoromethyl)amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-[3-[bis(trifluoromethyl)amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 15209637 |
| Molecular Formula | C19H18F6N2O4 |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | dimethyl 4-[3-[bis(trifluoromethyl)amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1cccc(N(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18F6N2O4/c1-9-13(16(28)30-3)15(14(10(2)26-9)17(29)31-4)11-6-5-7-12(8-11)27(18(20,21)22)19(23,24)25/h5-8,15,26H,1-4H3 |
| InChIKey | VRHUBFOLIBRPFS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|