C23H26N2O6 — CID 135415148
dimethyl 4-[3-[[(Z)-2-acetyl-3-hydroxybut-2-enylidene]amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 135415148) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is dimethyl 4-[3-[[(Z)-2-acetyl-3-hydroxybut-2-enylidene]amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-[3-[[(Z)-2-acetyl-3-hydroxybut-2-enylidene]amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 135415148 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | dimethyl 4-[3-[[(Z)-2-acetyl-3-hydroxybut-2-enylidene]amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1cccc(/N=C/C(C(C)=O)=C(\C)O)c1 |
| InChI | InChI=1S/C23H26N2O6/c1-12-19(22(28)30-5)21(20(13(2)25-12)23(29)31-6)16-8-7-9-17(10-16)24-11-18(14(3)26)15(4)27/h7-11,21,25-26H,1-6H3/b18-14-,24-11+ |
| InChIKey | GSLPWABPXZSLMU-PSSUUKRPSA-N |
| XLogP | 3.39 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|