C25H30N2O8 — CID 135541245
dimethyl 4-[3-[[(E)-3-hydroxy-2-(2-methoxyethoxycarbonyl)but-2-enylidene]amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 135541245) has the molecular formula C25H30N2O8 and a molecular weight of 486.52 g/mol. Its IUPAC name is dimethyl 4-[3-[[(E)-3-hydroxy-2-(2-methoxyethoxycarbonyl)but-2-enylidene]amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-[3-[[(E)-3-hydroxy-2-(2-methoxyethoxycarbonyl)but-2-enylidene]amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 135541245 |
| Molecular Formula | C25H30N2O8 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | dimethyl 4-[3-[[(E)-3-hydroxy-2-(2-methoxyethoxycarbonyl)but-2-enylidene]amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COCCOC(=O)C(/C=N/c1cccc(C2C(C(=O)OC)=C(C)NC(C)=C2C(=O)OC)c1)=C(\C)O |
| InChI | InChI=1S/C25H30N2O8/c1-14-20(24(30)33-5)22(21(15(2)27-14)25(31)34-6)17-8-7-9-18(12-17)26-13-19(16(3)28)23(29)35-11-10-32-4/h7-9,12-13,22,27-28H,10-11H2,1-6H3/b19-16+,26-13+ |
| InChIKey | YATMXFOZHRQWQO-PCFQKQQSSA-N |
| XLogP | 2.99 |
| TPSA | 132.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|