C9H14Cl6NO3P — CID 102097676
N-[bis(2,2,2-trichloroethoxy)phosphoryl]cyclopentanamine (PubChem CID 102097676) has the molecular formula C9H14Cl6NO3P and a molecular weight of 427.91 g/mol. Its IUPAC name is N-[bis(2,2,2-trichloroethoxy)phosphoryl]cyclopentanamine.
| Compound Name | N-[bis(2,2,2-trichloroethoxy)phosphoryl]cyclopentanamine |
|---|---|
| PubChem CID | 102097676 |
| Molecular Formula | C9H14Cl6NO3P |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 424.88 |
| IUPAC Name | N-[bis(2,2,2-trichloroethoxy)phosphoryl]cyclopentanamine |
| SMILES | O=P(NC1CCCC1)(OCC(Cl)(Cl)Cl)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H14Cl6NO3P/c10-8(11,12)5-18-20(17,19-6-9(13,14)15)16-7-3-1-2-4-7/h7H,1-6H2,(H,16,17) |
| InChIKey | ONHWPPSODXNIBE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|