C26H24N2O6 — CID 102097757
2-cyanoethyl 2-methyl-5-oxo-4-(3,4,5-trimethoxyphenyl)-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate (PubChem CID 102097757) has the molecular formula C26H24N2O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is 2-cyanoethyl 2-methyl-5-oxo-4-(3,4,5-trimethoxyphenyl)-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate.
| Compound Name | 2-cyanoethyl 2-methyl-5-oxo-4-(3,4,5-trimethoxyphenyl)-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 102097757 |
| Molecular Formula | C26H24N2O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-cyanoethyl 2-methyl-5-oxo-4-(3,4,5-trimethoxyphenyl)-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate |
| SMILES | COc1cc(C2C(C(=O)OCCC#N)=C(C)NC3=C2C(=O)c2ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C26H24N2O6/c1-14-20(26(30)34-11-7-10-27)21(15-12-18(31-2)25(33-4)19(13-15)32-3)22-23(28-14)16-8-5-6-9-17(16)24(22)29/h5-6,8-9,12-13,21,28H,7,11H2,1-4H3 |
| InChIKey | YRNQQTLBRZGAFT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 106.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dhp_keto_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|