C25H22N4O — CID 102100633
5-tert-butylimino-6-phenylquinazolino[2,3-a]phthalazin-8-one (PubChem CID 102100633) has the molecular formula C25H22N4O and a molecular weight of 394.48 g/mol. Its IUPAC name is 5-tert-butylimino-6-phenylquinazolino[2,3-a]phthalazin-8-one.
| Compound Name | 5-tert-butylimino-6-phenylquinazolino[2,3-a]phthalazin-8-one |
|---|---|
| PubChem CID | 102100633 |
| Molecular Formula | C25H22N4O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 5-tert-butylimino-6-phenylquinazolino[2,3-a]phthalazin-8-one |
| SMILES | CC(C)(C)/N=c1\c2ccccc2c2nc3ccccc3c(=O)n2n1-c1ccccc1 |
| InChI | InChI=1S/C25H22N4O/c1-25(2,3)27-23-19-14-8-7-13-18(19)22-26-21-16-10-9-15-20(21)24(30)29(22)28(23)17-11-5-4-6-12-17/h4-16H,1-3H3/b27-23+ |
| InChIKey | BSFFYVIYBXZNGZ-SLEBQGDGSA-N |
| XLogP | 4.49 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|