C21H12ClN3O2 — CID 132500625
10-chloro-5-phenylquinazolino[3,2-b]cinnoline-7,13-dione (PubChem CID 132500625) has the molecular formula C21H12ClN3O2 and a molecular weight of 373.80 g/mol. Its IUPAC name is 10-chloro-5-phenylquinazolino[3,2-b]cinnoline-7,13-dione.
| Compound Name | 10-chloro-5-phenylquinazolino[3,2-b]cinnoline-7,13-dione |
|---|---|
| PubChem CID | 132500625 |
| Molecular Formula | C21H12ClN3O2 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 10-chloro-5-phenylquinazolino[3,2-b]cinnoline-7,13-dione |
| SMILES | O=c1c2ccccc2n(-c2ccccc2)n2c(=O)c3ccc(Cl)cc3nc12 |
| InChI | InChI=1S/C21H12ClN3O2/c22-13-10-11-15-17(12-13)23-20-19(26)16-8-4-5-9-18(16)24(25(20)21(15)27)14-6-2-1-3-7-14/h1-12H |
| InChIKey | FFCBXKDIRGDQBV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 56.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|